C21H20N2O3 — CID 142153800
N-[3-(1,3-dioxoisoindol-2-yl)propyl]-N-(2-methylphenyl)prop-2-enamide (PubChem CID 142153800) has the molecular formula C21H20N2O3 and a molecular weight of 348.40 g/mol. Its IUPAC name is N-[3-(1,3-dioxoisoindol-2-yl)propyl]-N-(2-methylphenyl)prop-2-enamide.
| Compound Name | N-[3-(1,3-dioxoisoindol-2-yl)propyl]-N-(2-methylphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 142153800 |
| Molecular Formula | C21H20N2O3 |
| Molecular Weight | 348.40 g/mol |
| Exact Mass | 348.15 |
| IUPAC Name | N-[3-(1,3-dioxoisoindol-2-yl)propyl]-N-(2-methylphenyl)prop-2-enamide |
| SMILES | C=CC(=O)N(CCCN1C(=O)c2ccccc2C1=O)c1ccccc1C |
| InChI | InChI=1S/C21H20N2O3/c1-3-19(24)22(18-12-7-4-9-15(18)2)13-8-14-23-20(25)16-10-5-6-11-17(16)21(23)26/h3-7,9-12H,1,8,13-14H2,2H3 |
| InChIKey | BQJZNNUFAIWTAD-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.40 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|