C17H28FN3O — CID 142156936
(3Z,4Z,6Z)-N,N-diethyl-3-(fluoromethylidene)-2-piperazin-1-ylocta-4,6-dienamide (PubChem CID 142156936) has the molecular formula C17H28FN3O and a molecular weight of 309.43 g/mol. Its IUPAC name is (3Z,4Z,6Z)-N,N-diethyl-3-(fluoromethylidene)-2-piperazin-1-ylocta-4,6-dienamide.
| Compound Name | (3Z,4Z,6Z)-N,N-diethyl-3-(fluoromethylidene)-2-piperazin-1-ylocta-4,6-dienamide |
|---|---|
| PubChem CID | 142156936 |
| Molecular Formula | C17H28FN3O |
| Molecular Weight | 309.43 g/mol |
| Exact Mass | 309.22 |
| IUPAC Name | (3Z,4Z,6Z)-N,N-diethyl-3-(fluoromethylidene)-2-piperazin-1-ylocta-4,6-dienamide |
| SMILES | C/C=C\C=C/C(=C/F)C(C(=O)N(CC)CC)N1CCNCC1 |
| InChI | InChI=1S/C17H28FN3O/c1-4-7-8-9-15(14-18)16(17(22)20(5-2)6-3)21-12-10-19-11-13-21/h4,7-9,14,16,19H,5-6,10-13H2,1-3H3/b7-4-,9-8-,15-14- |
| InChIKey | AGSXNXHGFZTVQM-ZYINRLSFSA-N |
| XLogP | 2.11 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.43 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|