C18H27F3N2O — CID 166078277
(3E,5E)-N-(4,4-difluorocyclohexyl)-3-ethenyl-5-fluoro-2-(prop-2-enylamino)hepta-3,5-dienamide;molecular hydrogen (PubChem CID 166078277) has the molecular formula C18H27F3N2O and a molecular weight of 344.42 g/mol. Its IUPAC name is (3E,5E)-N-(4,4-difluorocyclohexyl)-3-ethenyl-5-fluoro-2-(prop-2-enylamino)hepta-3,5-dienamide;molecular hydrogen.
| Compound Name | (3E,5E)-N-(4,4-difluorocyclohexyl)-3-ethenyl-5-fluoro-2-(prop-2-enylamino)hepta-3,5-dienamide;molecular hydrogen |
|---|---|
| PubChem CID | 166078277 |
| Molecular Formula | C18H27F3N2O |
| Molecular Weight | 344.42 g/mol |
| Exact Mass | 344.21 |
| IUPAC Name | (3E,5E)-N-(4,4-difluorocyclohexyl)-3-ethenyl-5-fluoro-2-(prop-2-enylamino)hepta-3,5-dienamide;molecular hydrogen |
| SMILES | C=CCNC(C(=O)NC1CCC(F)(F)CC1)/C(C=C)=C/C(F)=C\C.[H][H] |
| InChI | InChI=1S/C18H25F3N2O.H2/c1-4-11-22-16(13(5-2)12-14(19)6-3)17(24)23-15-7-9-18(20,21)10-8-15;/h4-6,12,15-16,22H,1-2,7-11H2,3H3,(H,23,24);1H/b13-12+,14-6+; |
| InChIKey | JITJXALCODJEJH-HXOCTPBGSA-N |
| XLogP | 4.06 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.42 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|