C19H25F5N2O — CID 166078128
(3Z,5Z)-N-(4,4-difluorocyclohexyl)-3-ethenyl-2-(prop-2-enylamino)-4-(trifluoromethyl)hepta-3,5-dienamide (PubChem CID 166078128) has the molecular formula C19H25F5N2O and a molecular weight of 392.41 g/mol. Its IUPAC name is (3Z,5Z)-N-(4,4-difluorocyclohexyl)-3-ethenyl-2-(prop-2-enylamino)-4-(trifluoromethyl)hepta-3,5-dienamide.
| Compound Name | (3Z,5Z)-N-(4,4-difluorocyclohexyl)-3-ethenyl-2-(prop-2-enylamino)-4-(trifluoromethyl)hepta-3,5-dienamide |
|---|---|
| PubChem CID | 166078128 |
| Molecular Formula | C19H25F5N2O |
| Molecular Weight | 392.41 g/mol |
| Exact Mass | 392.19 |
| IUPAC Name | (3Z,5Z)-N-(4,4-difluorocyclohexyl)-3-ethenyl-2-(prop-2-enylamino)-4-(trifluoromethyl)hepta-3,5-dienamide |
| SMILES | C=CCNC(C(=O)NC1CCC(F)(F)CC1)/C(C=C)=C(/C=C\C)C(F)(F)F |
| InChI | InChI=1S/C19H25F5N2O/c1-4-7-15(19(22,23)24)14(6-3)16(25-12-5-2)17(27)26-13-8-10-18(20,21)11-9-13/h4-7,13,16,25H,2-3,8-12H2,1H3,(H,26,27)/b7-4-,15-14- |
| InChIKey | YORDLQOJVNJVDC-OCBXTPAXSA-N |
| XLogP | 4.45 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.41 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|