C23H18N4O — CID 142172508
N-[4-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-N-methylformamide (PubChem CID 142172508) has the molecular formula C23H18N4O and a molecular weight of 366.42 g/mol. Its IUPAC name is N-[4-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-N-methylformamide.
| Compound Name | N-[4-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-N-methylformamide |
|---|---|
| PubChem CID | 142172508 |
| Molecular Formula | C23H18N4O |
| Molecular Weight | 366.42 g/mol |
| Exact Mass | 366.15 |
| IUPAC Name | N-[4-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-N-methylformamide |
| SMILES | CN(C=O)c1ccc(-c2nc(-c3ccccc3)nc(-c3ccccc3)n2)cc1 |
| InChI | InChI=1S/C23H18N4O/c1-27(16-28)20-14-12-19(13-15-20)23-25-21(17-8-4-2-5-9-17)24-22(26-23)18-10-6-3-7-11-18/h2-16H,1H3 |
| InChIKey | IVTAXCLABCEBAR-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 58.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.42 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|