C21H37NO3 — CID 142177274
(10E,12Z)-3-hydroxy-4,4,6,8,12-pentamethyl-15-(methylamino)-5-oxopentadeca-10,12-dienal (PubChem CID 142177274) has the molecular formula C21H37NO3 and a molecular weight of 351.53 g/mol. Its IUPAC name is (10E,12Z)-3-hydroxy-4,4,6,8,12-pentamethyl-15-(methylamino)-5-oxopentadeca-10,12-dienal.
| Compound Name | (10E,12Z)-3-hydroxy-4,4,6,8,12-pentamethyl-15-(methylamino)-5-oxopentadeca-10,12-dienal |
|---|---|
| PubChem CID | 142177274 |
| Molecular Formula | C21H37NO3 |
| Molecular Weight | 351.53 g/mol |
| Exact Mass | 351.28 |
| IUPAC Name | (10E,12Z)-3-hydroxy-4,4,6,8,12-pentamethyl-15-(methylamino)-5-oxopentadeca-10,12-dienal |
| SMILES | CNCC/C=C(C)\C=C\CC(C)CC(C)C(=O)C(C)(C)C(O)CC=O |
| InChI | InChI=1S/C21H37NO3/c1-16(11-8-13-22-6)9-7-10-17(2)15-18(3)20(25)21(4,5)19(24)12-14-23/h7,9,11,14,17-19,22,24H,8,10,12-13,15H2,1-6H3/b9-7+,16-11- |
| InChIKey | RNIUGHLVQVNURT-SZFVZERQSA-N |
| XLogP | 3.70 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.53 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|