C21H37NO3 — CID 142177236
N-[(3Z,5E)-13-hydroxy-4,8,10,12,12-pentamethyl-11-oxopentadeca-3,5-dienyl]formamide (PubChem CID 142177236) has the molecular formula C21H37NO3 and a molecular weight of 351.53 g/mol. Its IUPAC name is N-[(3Z,5E)-13-hydroxy-4,8,10,12,12-pentamethyl-11-oxopentadeca-3,5-dienyl]formamide.
| Compound Name | N-[(3Z,5E)-13-hydroxy-4,8,10,12,12-pentamethyl-11-oxopentadeca-3,5-dienyl]formamide |
|---|---|
| PubChem CID | 142177236 |
| Molecular Formula | C21H37NO3 |
| Molecular Weight | 351.53 g/mol |
| Exact Mass | 351.28 |
| IUPAC Name | N-[(3Z,5E)-13-hydroxy-4,8,10,12,12-pentamethyl-11-oxopentadeca-3,5-dienyl]formamide |
| SMILES | CCC(O)C(C)(C)C(=O)C(C)CC(C)C/C=C/C(C)=C\CCNC=O |
| InChI | InChI=1S/C21H37NO3/c1-7-19(24)21(5,6)20(25)18(4)14-17(3)11-8-10-16(2)12-9-13-22-15-23/h8,10,12,15,17-19,24H,7,9,11,13-14H2,1-6H3,(H,22,23)/b10-8+,16-12- |
| InChIKey | NDORNDOYBLGOTG-FCLVZERKSA-N |
| XLogP | 4.04 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.53 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|