C15H19NS — CID 142177843
(Z,2E)-N,3-bis(ethenyl)-2-[(2-methyl-2,3-dihydrothiophen-3-yl)methylidene]pent-3-en-1-imine (PubChem CID 142177843) has the molecular formula C15H19NS and a molecular weight of 245.39 g/mol. Its IUPAC name is (Z,2E)-N,3-bis(ethenyl)-2-[(2-methyl-2,3-dihydrothiophen-3-yl)methylidene]pent-3-en-1-imine.
| Compound Name | (Z,2E)-N,3-bis(ethenyl)-2-[(2-methyl-2,3-dihydrothiophen-3-yl)methylidene]pent-3-en-1-imine |
|---|---|
| PubChem CID | 142177843 |
| Molecular Formula | C15H19NS |
| Molecular Weight | 245.39 g/mol |
| Exact Mass | 245.12 |
| IUPAC Name | (Z,2E)-N,3-bis(ethenyl)-2-[(2-methyl-2,3-dihydrothiophen-3-yl)methylidene]pent-3-en-1-imine |
| SMILES | C=C/N=C/C(=CC1C=CSC1C)/C(C=C)=C\C |
| InChI | InChI=1S/C15H19NS/c1-5-13(6-2)15(11-16-7-3)10-14-8-9-17-12(14)4/h5-12,14H,1,3H2,2,4H3/b13-6-,15-10-,16-11+ |
| InChIKey | MVQTYQOYDFWIOK-DDLYTFIZSA-N |
| XLogP | 4.52 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.39 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|