C24H24N2O3 — CID 142180485
2-hydroxy-3-[[3-methylidene-4-oxo-2-[(2-phenylcyclohexyl)amino]cyclobuten-1-yl]amino]benzaldehyde (PubChem CID 142180485) has the molecular formula C24H24N2O3 and a molecular weight of 388.47 g/mol. Its IUPAC name is 2-hydroxy-3-[[3-methylidene-4-oxo-2-[(2-phenylcyclohexyl)amino]cyclobuten-1-yl]amino]benzaldehyde.
| Compound Name | 2-hydroxy-3-[[3-methylidene-4-oxo-2-[(2-phenylcyclohexyl)amino]cyclobuten-1-yl]amino]benzaldehyde |
|---|---|
| PubChem CID | 142180485 |
| Molecular Formula | C24H24N2O3 |
| Molecular Weight | 388.47 g/mol |
| Exact Mass | 388.18 |
| IUPAC Name | 2-hydroxy-3-[[3-methylidene-4-oxo-2-[(2-phenylcyclohexyl)amino]cyclobuten-1-yl]amino]benzaldehyde |
| SMILES | C=C1C(=O)C(Nc2cccc(C=O)c2O)=C1NC1CCCCC1c1ccccc1 |
| InChI | InChI=1S/C24H24N2O3/c1-15-21(22(23(15)28)26-20-13-7-10-17(14-27)24(20)29)25-19-12-6-5-11-18(19)16-8-3-2-4-9-16/h2-4,7-10,13-14,18-19,25-26,29H,1,5-6,11-12H2 |
| InChIKey | LUTYRXWDZQVQQX-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.47 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|