C14H19N — CID 142186727
4-(6-methylhepta-1,5-dien-2-yl)aniline (PubChem CID 142186727) has the molecular formula C14H19N and a molecular weight of 201.31 g/mol. Its IUPAC name is 4-(6-methylhepta-1,5-dien-2-yl)aniline.
| Compound Name | 4-(6-methylhepta-1,5-dien-2-yl)aniline |
|---|---|
| PubChem CID | 142186727 |
| Molecular Formula | C14H19N |
| Molecular Weight | 201.31 g/mol |
| Exact Mass | 201.15 |
| IUPAC Name | 4-(6-methylhepta-1,5-dien-2-yl)aniline |
| SMILES | C=C(CCC=C(C)C)c1ccc(N)cc1 |
| InChI | InChI=1S/C14H19N/c1-11(2)5-4-6-12(3)13-7-9-14(15)10-8-13/h5,7-10H,3-4,6,15H2,1-2H3 |
| InChIKey | XGEPQVGYMYBLMN-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.31 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|