C9H16O — CID 142188671
(2R)-2,3-dimethylcyclopent-3-en-1-one;ethane (PubChem CID 142188671) has the molecular formula C9H16O and a molecular weight of 140.23 g/mol. Its IUPAC name is (2R)-2,3-dimethylcyclopent-3-en-1-one;ethane.
| Compound Name | (2R)-2,3-dimethylcyclopent-3-en-1-one;ethane |
|---|---|
| PubChem CID | 142188671 |
| Molecular Formula | C9H16O |
| Molecular Weight | 140.23 g/mol |
| Exact Mass | 140.12 |
| IUPAC Name | (2R)-2,3-dimethylcyclopent-3-en-1-one;ethane |
| SMILES | CC.CC1=CCC(=O)[C@@H]1C |
| InChI | InChI=1S/C7H10O.C2H6/c1-5-3-4-7(8)6(5)2;1-2/h3,6H,4H2,1-2H3;1-2H3/t6-;/m1./s1 |
| InChIKey | LLAQIRZRXOFCGQ-FYZOBXCZSA-N |
| XLogP | 2.57 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 140.23 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|