C26H34N2O4 — CID 142189569
3,4-dihydro-2H-chromene;(2R)-N-(2-hydroxypropan-2-yl)-2-methylpent-4-enamide;2-methylfuro[3,2-c]pyridine (PubChem CID 142189569) has the molecular formula C26H34N2O4 and a molecular weight of 438.57 g/mol. Its IUPAC name is 3,4-dihydro-2H-chromene;(2R)-N-(2-hydroxypropan-2-yl)-2-methylpent-4-enamide;2-methylfuro[3,2-c]pyridine.
| Compound Name | 3,4-dihydro-2H-chromene;(2R)-N-(2-hydroxypropan-2-yl)-2-methylpent-4-enamide;2-methylfuro[3,2-c]pyridine |
|---|---|
| PubChem CID | 142189569 |
| Molecular Formula | C26H34N2O4 |
| Molecular Weight | 438.57 g/mol |
| Exact Mass | 438.25 |
| IUPAC Name | 3,4-dihydro-2H-chromene;(2R)-N-(2-hydroxypropan-2-yl)-2-methylpent-4-enamide;2-methylfuro[3,2-c]pyridine |
| SMILES | C=CC[C@@H](C)C(=O)NC(C)(C)O.Cc1cc2cnccc2o1.c1ccc2c(c1)CCCO2 |
| InChI | InChI=1S/C9H17NO2.C9H10O.C8H7NO/c1-5-6-7(2)8(11)10-9(3,4)12;1-2-6-9-8(4-1)5-3-7-10-9;1-6-4-7-5-9-3-2-8(7)10-6/h5,7,12H,1,6H2,2-4H3,(H,10,11);1-2,4,6H,3,5,7H2;2-5H,1H3/t7-;;/m1../s1 |
| InChIKey | VGNMFHWBCLKOFO-XCUBXKJBSA-N |
| XLogP | 5.19 |
| TPSA | 84.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.57 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|