C15H15NOS2 — CID 142192849
3-[(2E,4E)-5-hydroxy-6-methylhepta-2,4,6-trienyl]-1,3-benzothiazole-2-thione (PubChem CID 142192849) has the molecular formula C15H15NOS2 and a molecular weight of 289.43 g/mol. Its IUPAC name is 3-[(2E,4E)-5-hydroxy-6-methylhepta-2,4,6-trienyl]-1,3-benzothiazole-2-thione.
| Compound Name | 3-[(2E,4E)-5-hydroxy-6-methylhepta-2,4,6-trienyl]-1,3-benzothiazole-2-thione |
|---|---|
| PubChem CID | 142192849 |
| Molecular Formula | C15H15NOS2 |
| Molecular Weight | 289.43 g/mol |
| Exact Mass | 289.06 |
| IUPAC Name | 3-[(2E,4E)-5-hydroxy-6-methylhepta-2,4,6-trienyl]-1,3-benzothiazole-2-thione |
| SMILES | C=C(C)/C(O)=C\C=C\Cn1c(=S)sc2ccccc21 |
| InChI | InChI=1S/C15H15NOS2/c1-11(2)13(17)8-5-6-10-16-12-7-3-4-9-14(12)19-15(16)18/h3-9,17H,1,10H2,2H3/b6-5+,13-8+ |
| InChIKey | QUIJTPCCPATPPQ-RJZLBLBSSA-N |
| XLogP | 5.01 |
| TPSA | 25.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.43 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|