C14H14Cl2N2OS2 — CID 146050424
3-[(4-hydroxyanilino)methyl]-1,3-benzothiazole-2-thione;dihydrochloride (PubChem CID 146050424) has the molecular formula C14H14Cl2N2OS2 and a molecular weight of 361.32 g/mol. Its IUPAC name is 3-[(4-hydroxyanilino)methyl]-1,3-benzothiazole-2-thione;dihydrochloride.
| Compound Name | 3-[(4-hydroxyanilino)methyl]-1,3-benzothiazole-2-thione;dihydrochloride |
|---|---|
| PubChem CID | 146050424 |
| Molecular Formula | C14H14Cl2N2OS2 |
| Molecular Weight | 361.32 g/mol |
| Exact Mass | 359.99 |
| IUPAC Name | 3-[(4-hydroxyanilino)methyl]-1,3-benzothiazole-2-thione;dihydrochloride |
| SMILES | Cl.Cl.Oc1ccc(NCn2c(=S)sc3ccccc32)cc1 |
| InChI | InChI=1S/C14H12N2OS2.2ClH/c17-11-7-5-10(6-8-11)15-9-16-12-3-1-2-4-13(12)19-14(16)18;;/h1-8,15,17H,9H2;2*1H |
| InChIKey | PLTDPMVCVPHVTQ-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 37.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.32 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|