C23H27N3S4 — CID 10322639
3-[[(2-octylsulfanyl-1,3-benzothiazol-6-yl)amino]methyl]-1,3-benzothiazole-2-thione (PubChem CID 10322639) has the molecular formula C23H27N3S4 and a molecular weight of 473.76 g/mol. Its IUPAC name is 3-[[(2-octylsulfanyl-1,3-benzothiazol-6-yl)amino]methyl]-1,3-benzothiazole-2-thione.
| Compound Name | 3-[[(2-octylsulfanyl-1,3-benzothiazol-6-yl)amino]methyl]-1,3-benzothiazole-2-thione |
|---|---|
| PubChem CID | 10322639 |
| Molecular Formula | C23H27N3S4 |
| Molecular Weight | 473.76 g/mol |
| Exact Mass | 473.11 |
| IUPAC Name | 3-[[(2-octylsulfanyl-1,3-benzothiazol-6-yl)amino]methyl]-1,3-benzothiazole-2-thione |
| SMILES | CCCCCCCCSc1nc2ccc(NCn3c(=S)sc4ccccc43)cc2s1 |
| InChI | InChI=1S/C23H27N3S4/c1-2-3-4-5-6-9-14-28-22-25-18-13-12-17(15-21(18)29-22)24-16-26-19-10-7-8-11-20(19)30-23(26)27/h7-8,10-13,15,24H,2-6,9,14,16H2,1H3 |
| InChIKey | HNFUGPOTEIQRRC-UHFFFAOYSA-N |
| XLogP | 8.56 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.76 |
| LogP ≤ 5 | 8.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|