C24H29N3S4 — CID 15230926
3-[[(2-nonylsulfanyl-1,3-benzothiazol-6-yl)amino]methyl]-1,3-benzothiazole-2-thione (PubChem CID 15230926) has the molecular formula C24H29N3S4 and a molecular weight of 487.79 g/mol. Its IUPAC name is 3-[[(2-nonylsulfanyl-1,3-benzothiazol-6-yl)amino]methyl]-1,3-benzothiazole-2-thione.
| Compound Name | 3-[[(2-nonylsulfanyl-1,3-benzothiazol-6-yl)amino]methyl]-1,3-benzothiazole-2-thione |
|---|---|
| PubChem CID | 15230926 |
| Molecular Formula | C24H29N3S4 |
| Molecular Weight | 487.79 g/mol |
| Exact Mass | 487.12 |
| IUPAC Name | 3-[[(2-nonylsulfanyl-1,3-benzothiazol-6-yl)amino]methyl]-1,3-benzothiazole-2-thione |
| SMILES | CCCCCCCCCSc1nc2ccc(NCn3c(=S)sc4ccccc43)cc2s1 |
| InChI | InChI=1S/C24H29N3S4/c1-2-3-4-5-6-7-10-15-29-23-26-19-14-13-18(16-22(19)30-23)25-17-27-20-11-8-9-12-21(20)31-24(27)28/h8-9,11-14,16,25H,2-7,10,15,17H2,1H3 |
| InChIKey | MQLPGKRMLKIEAS-UHFFFAOYSA-N |
| XLogP | 8.95 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.79 |
| LogP ≤ 5 | 8.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|