C30H33F4N3O4 — CID 142195213
2-N-[4-[3-fluoro-5-[(3S)-3-hydroxy-4-[[3-(trifluoromethyl)phenyl]methylamino]butyl]phenoxy]butyl]-3-prop-2-ynylcycloprop-2-ene-1,2-dicarboxamide (PubChem CID 142195213) has the molecular formula C30H33F4N3O4 and a molecular weight of 575.60 g/mol. Its IUPAC name is 2-N-[4-[3-fluoro-5-[(3S)-3-hydroxy-4-[[3-(trifluoromethyl)phenyl]methylamino]butyl]phenoxy]butyl]-3-prop-2-ynylcycloprop-2-ene-1,2-dicarboxamide.
| Compound Name | 2-N-[4-[3-fluoro-5-[(3S)-3-hydroxy-4-[[3-(trifluoromethyl)phenyl]methylamino]butyl]phenoxy]butyl]-3-prop-2-ynylcycloprop-2-ene-1,2-dicarboxamide |
|---|---|
| PubChem CID | 142195213 |
| Molecular Formula | C30H33F4N3O4 |
| Molecular Weight | 575.60 g/mol |
| Exact Mass | 575.24 |
| IUPAC Name | 2-N-[4-[3-fluoro-5-[(3S)-3-hydroxy-4-[[3-(trifluoromethyl)phenyl]methylamino]butyl]phenoxy]butyl]-3-prop-2-ynylcycloprop-2-ene-1,2-dicarboxamide |
| SMILES | C#CCC1=C(C(=O)NCCCCOc2cc(F)cc(CC[C@H](O)CNCc3cccc(C(F)(F)F)c3)c2)C1C(N)=O |
| InChI | InChI=1S/C30H33F4N3O4/c1-2-6-25-26(28(35)39)27(25)29(40)37-11-3-4-12-41-24-15-19(14-22(31)16-24)9-10-23(38)18-36-17-20-7-5-8-21(13-20)30(32,33)34/h1,5,7-8,13-16,23,26,36,38H,3-4,6,9-12,17-18H2,(H2,35,39)(H,37,40)/t23-,26?/m0/s1 |
| InChIKey | OYHSQEPLVIDAJI-ZZHFZYNASA-N |
| XLogP | 3.64 |
| TPSA | 113.68 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.60 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|