C28H33N2O2+ — CID 142216894
[(S)-[(2R,4S,5R)-5-ethenyl-4-ethylpiperidin-1-ium-2-yl]-quinolin-4-ylmethyl] 3-phenylpropanoate (PubChem CID 142216894) has the molecular formula C28H33N2O2+ and a molecular weight of 429.58 g/mol. Its IUPAC name is [(S)-[(2R,4S,5R)-5-ethenyl-4-ethylpiperidin-1-ium-2-yl]-quinolin-4-ylmethyl] 3-phenylpropanoate.
| Compound Name | [(S)-[(2R,4S,5R)-5-ethenyl-4-ethylpiperidin-1-ium-2-yl]-quinolin-4-ylmethyl] 3-phenylpropanoate |
|---|---|
| PubChem CID | 142216894 |
| Molecular Formula | C28H33N2O2+ |
| Molecular Weight | 429.58 g/mol |
| Exact Mass | 429.25 |
| IUPAC Name | [(S)-[(2R,4S,5R)-5-ethenyl-4-ethylpiperidin-1-ium-2-yl]-quinolin-4-ylmethyl] 3-phenylpropanoate |
| SMILES | C=C[C@H]1C[NH2+][C@@H]([C@@H](OC(=O)CCc2ccccc2)c2ccnc3ccccc23)C[C@@H]1CC |
| InChI | InChI=1S/C28H32N2O2/c1-3-21-18-26(30-19-22(21)4-2)28(24-16-17-29-25-13-9-8-12-23(24)25)32-27(31)15-14-20-10-6-5-7-11-20/h4-13,16-17,21-22,26,28,30H,2-3,14-15,18-19H2,1H3/p+1/t21-,22-,26+,28-/m0/s1 |
| InChIKey | CYTGOHNLAPUGBL-SPXQGQSESA-O |
| XLogP | 4.62 |
| TPSA | 55.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.58 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|