C25H27F3N4O2 — CID 142224719
1-[(3E,5Z)-hepta-1,3,5-trien-4-yl]-2-[[(3E)-hexa-1,3,5-trien-3-yl]amino]-7-(3-hydroxypropylamino)-5-(trifluoromethyl)-1,8-naphthyridin-4-one (PubChem CID 142224719) has the molecular formula C25H27F3N4O2 and a molecular weight of 472.51 g/mol. Its IUPAC name is 1-[(3E,5Z)-hepta-1,3,5-trien-4-yl]-2-[[(3E)-hexa-1,3,5-trien-3-yl]amino]-7-(3-hydroxypropylamino)-5-(trifluoromethyl)-1,8-naphthyridin-4-one.
| Compound Name | 1-[(3E,5Z)-hepta-1,3,5-trien-4-yl]-2-[[(3E)-hexa-1,3,5-trien-3-yl]amino]-7-(3-hydroxypropylamino)-5-(trifluoromethyl)-1,8-naphthyridin-4-one |
|---|---|
| PubChem CID | 142224719 |
| Molecular Formula | C25H27F3N4O2 |
| Molecular Weight | 472.51 g/mol |
| Exact Mass | 472.21 |
| IUPAC Name | 1-[(3E,5Z)-hepta-1,3,5-trien-4-yl]-2-[[(3E)-hexa-1,3,5-trien-3-yl]amino]-7-(3-hydroxypropylamino)-5-(trifluoromethyl)-1,8-naphthyridin-4-one |
| SMILES | C=C/C=C(\C=C)Nc1cc(=O)c2c(C(F)(F)F)cc(NCCCO)nc2n1C(/C=C\C)=C/C=C |
| InChI | InChI=1S/C25H27F3N4O2/c1-5-10-17(8-4)30-22-16-20(34)23-19(25(26,27)28)15-21(29-13-9-14-33)31-24(23)32(22)18(11-6-2)12-7-3/h5-8,10-12,15-16,30,33H,1-2,4,9,13-14H2,3H3,(H,29,31)/b12-7-,17-10+,18-11+ |
| InChIKey | ZAWLLTYRPPIYHO-REDARZTRSA-N |
| XLogP | 5.48 |
| TPSA | 79.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.51 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|