C18H24N2S — CID 142225859
[(1E,3E,4Z)-3-ethylidenehepta-1,4-dienyl] N,5-dimethyl-4H-azepine-6-carboximidothioate (PubChem CID 142225859) has the molecular formula C18H24N2S and a molecular weight of 300.47 g/mol. Its IUPAC name is [(1E,3E,4Z)-3-ethylidenehepta-1,4-dienyl] N,5-dimethyl-4H-azepine-6-carboximidothioate.
| Compound Name | [(1E,3E,4Z)-3-ethylidenehepta-1,4-dienyl] N,5-dimethyl-4H-azepine-6-carboximidothioate |
|---|---|
| PubChem CID | 142225859 |
| Molecular Formula | C18H24N2S |
| Molecular Weight | 300.47 g/mol |
| Exact Mass | 300.17 |
| IUPAC Name | [(1E,3E,4Z)-3-ethylidenehepta-1,4-dienyl] N,5-dimethyl-4H-azepine-6-carboximidothioate |
| SMILES | C/C=C(\C=C/CC)/C=C/S/C(=N\C)C1=C(C)CC=CN=C1 |
| InChI | InChI=1S/C18H24N2S/c1-5-7-10-16(6-2)11-13-21-18(19-4)17-14-20-12-8-9-15(17)3/h6-8,10-14H,5,9H2,1-4H3/b10-7-,13-11+,16-6+,19-18- |
| InChIKey | CPQKSVHDJDZZJM-PPCOJXQBSA-N |
| XLogP | 5.48 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.47 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|