C29H40N4OS — CID 142228549
1-[4-[[[4-(dimethylamino)quinazolin-2-yl]amino]methyl]cyclohexyl]-8-thiophen-2-yloctan-4-one (PubChem CID 142228549) has the molecular formula C29H40N4OS and a molecular weight of 492.73 g/mol. Its IUPAC name is 1-[4-[[[4-(dimethylamino)quinazolin-2-yl]amino]methyl]cyclohexyl]-8-thiophen-2-yloctan-4-one.
| Compound Name | 1-[4-[[[4-(dimethylamino)quinazolin-2-yl]amino]methyl]cyclohexyl]-8-thiophen-2-yloctan-4-one |
|---|---|
| PubChem CID | 142228549 |
| Molecular Formula | C29H40N4OS |
| Molecular Weight | 492.73 g/mol |
| Exact Mass | 492.29 |
| IUPAC Name | 1-[4-[[[4-(dimethylamino)quinazolin-2-yl]amino]methyl]cyclohexyl]-8-thiophen-2-yloctan-4-one |
| SMILES | CN(C)c1nc(NCC2CCC(CCCC(=O)CCCCc3cccs3)CC2)nc2ccccc12 |
| InChI | InChI=1S/C29H40N4OS/c1-33(2)28-26-14-5-6-15-27(26)31-29(32-28)30-21-23-18-16-22(17-19-23)9-7-11-24(34)10-3-4-12-25-13-8-20-35-25/h5-6,8,13-15,20,22-23H,3-4,7,9-12,16-19,21H2,1-2H3,(H,30,31,32) |
| InChIKey | DPKWUOQBFBEMGH-UHFFFAOYSA-N |
| XLogP | 7.13 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.73 |
| LogP ≤ 5 | 7.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|