C30H40N4OS — CID 142229217
N-[[2-[2-[4-(dimethylamino)quinazolin-2-yl]ethyl]spiro[2.5]octan-6-yl]methyl]-5-thiophen-2-ylpentanamide (PubChem CID 142229217) has the molecular formula C30H40N4OS and a molecular weight of 504.74 g/mol. Its IUPAC name is N-[[2-[2-[4-(dimethylamino)quinazolin-2-yl]ethyl]spiro[2.5]octan-6-yl]methyl]-5-thiophen-2-ylpentanamide.
| Compound Name | N-[[2-[2-[4-(dimethylamino)quinazolin-2-yl]ethyl]spiro[2.5]octan-6-yl]methyl]-5-thiophen-2-ylpentanamide |
|---|---|
| PubChem CID | 142229217 |
| Molecular Formula | C30H40N4OS |
| Molecular Weight | 504.74 g/mol |
| Exact Mass | 504.29 |
| IUPAC Name | N-[[2-[2-[4-(dimethylamino)quinazolin-2-yl]ethyl]spiro[2.5]octan-6-yl]methyl]-5-thiophen-2-ylpentanamide |
| SMILES | CN(C)c1nc(CCC2CC23CCC(CNC(=O)CCCCc2cccs2)CC3)nc2ccccc12 |
| InChI | InChI=1S/C30H40N4OS/c1-34(2)29-25-10-4-5-11-26(25)32-27(33-29)14-13-23-20-30(23)17-15-22(16-18-30)21-31-28(35)12-6-3-8-24-9-7-19-36-24/h4-5,7,9-11,19,22-23H,3,6,8,12-18,20-21H2,1-2H3,(H,31,35) |
| InChIKey | IGVHTCCXPSHPBE-UHFFFAOYSA-N |
| XLogP | 6.42 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.74 |
| LogP ≤ 5 | 6.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|