C16H32O2 — CID 142233546
[(5Z,6E)-5,6-di(ethylidene)oxan-2-yl]methanol;ethane;ethene (PubChem CID 142233546) has the molecular formula C16H32O2 and a molecular weight of 256.43 g/mol. Its IUPAC name is [(5Z,6E)-5,6-di(ethylidene)oxan-2-yl]methanol;ethane;ethene.
| Compound Name | [(5Z,6E)-5,6-di(ethylidene)oxan-2-yl]methanol;ethane;ethene |
|---|---|
| PubChem CID | 142233546 |
| Molecular Formula | C16H32O2 |
| Molecular Weight | 256.43 g/mol |
| Exact Mass | 256.24 |
| IUPAC Name | [(5Z,6E)-5,6-di(ethylidene)oxan-2-yl]methanol;ethane;ethene |
| SMILES | C/C=C1/CCC(CO)O/C1=C/C.C=C.CC.CC |
| InChI | InChI=1S/C10H16O2.2C2H6.C2H4/c1-3-8-5-6-9(7-11)12-10(8)4-2;3*1-2/h3-4,9,11H,5-7H2,1-2H3;2*1-2H3;1-2H2/b8-3-,10-4+;;; |
| InChIKey | VGJRSKNEGFTTJY-GFNFUAJNSA-N |
| XLogP | 4.86 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.43 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|