C27H35ClN4O4 — CID 142234477
(4-chloro-2-methoxyphenyl)-(4-cyclohexylpiperazin-1-yl)methanone;2-formamido-2-phenylacetamide (PubChem CID 142234477) has the molecular formula C27H35ClN4O4 and a molecular weight of 515.05 g/mol. Its IUPAC name is (4-chloro-2-methoxyphenyl)-(4-cyclohexylpiperazin-1-yl)methanone;2-formamido-2-phenylacetamide.
| Compound Name | (4-chloro-2-methoxyphenyl)-(4-cyclohexylpiperazin-1-yl)methanone;2-formamido-2-phenylacetamide |
|---|---|
| PubChem CID | 142234477 |
| Molecular Formula | C27H35ClN4O4 |
| Molecular Weight | 515.05 g/mol |
| Exact Mass | 514.23 |
| IUPAC Name | (4-chloro-2-methoxyphenyl)-(4-cyclohexylpiperazin-1-yl)methanone;2-formamido-2-phenylacetamide |
| SMILES | COc1cc(Cl)ccc1C(=O)N1CCN(C2CCCCC2)CC1.NC(=O)C(NC=O)c1ccccc1 |
| InChI | InChI=1S/C18H25ClN2O2.C9H10N2O2/c1-23-17-13-14(19)7-8-16(17)18(22)21-11-9-20(10-12-21)15-5-3-2-4-6-15;10-9(13)8(11-6-12)7-4-2-1-3-5-7/h7-8,13,15H,2-6,9-12H2,1H3;1-6,8H,(H2,10,13)(H,11,12) |
| InChIKey | UPLXTIBCBLFMEB-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 104.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.05 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|