C28H39ClN4O3 — CID 142234568
(2-chlorophenyl)-(4-cyclohexylpiperazin-1-yl)methanone;ethane;2-formamido-2-phenylacetamide (PubChem CID 142234568) has the molecular formula C28H39ClN4O3 and a molecular weight of 515.10 g/mol. Its IUPAC name is (2-chlorophenyl)-(4-cyclohexylpiperazin-1-yl)methanone;ethane;2-formamido-2-phenylacetamide.
| Compound Name | (2-chlorophenyl)-(4-cyclohexylpiperazin-1-yl)methanone;ethane;2-formamido-2-phenylacetamide |
|---|---|
| PubChem CID | 142234568 |
| Molecular Formula | C28H39ClN4O3 |
| Molecular Weight | 515.10 g/mol |
| Exact Mass | 514.27 |
| IUPAC Name | (2-chlorophenyl)-(4-cyclohexylpiperazin-1-yl)methanone;ethane;2-formamido-2-phenylacetamide |
| SMILES | CC.NC(=O)C(NC=O)c1ccccc1.O=C(c1ccccc1Cl)N1CCN(C2CCCCC2)CC1 |
| InChI | InChI=1S/C17H23ClN2O.C9H10N2O2.C2H6/c18-16-9-5-4-8-15(16)17(21)20-12-10-19(11-13-20)14-6-2-1-3-7-14;10-9(13)8(11-6-12)7-4-2-1-3-5-7;1-2/h4-5,8-9,14H,1-3,6-7,10-13H2;1-6,8H,(H2,10,13)(H,11,12);1-2H3 |
| InChIKey | UCBVCDUNAPDYEZ-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 95.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.10 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|