C28H37ClN4O3 — CID 142234618
(4-chloro-2-methylphenyl)-[4-(2-methylcyclohexyl)piperazin-1-yl]methanone;2-formamido-2-phenylacetamide (PubChem CID 142234618) has the molecular formula C28H37ClN4O3 and a molecular weight of 513.08 g/mol. Its IUPAC name is (4-chloro-2-methylphenyl)-[4-(2-methylcyclohexyl)piperazin-1-yl]methanone;2-formamido-2-phenylacetamide.
| Compound Name | (4-chloro-2-methylphenyl)-[4-(2-methylcyclohexyl)piperazin-1-yl]methanone;2-formamido-2-phenylacetamide |
|---|---|
| PubChem CID | 142234618 |
| Molecular Formula | C28H37ClN4O3 |
| Molecular Weight | 513.08 g/mol |
| Exact Mass | 512.26 |
| IUPAC Name | (4-chloro-2-methylphenyl)-[4-(2-methylcyclohexyl)piperazin-1-yl]methanone;2-formamido-2-phenylacetamide |
| SMILES | Cc1cc(Cl)ccc1C(=O)N1CCN(C2CCCCC2C)CC1.NC(=O)C(NC=O)c1ccccc1 |
| InChI | InChI=1S/C19H27ClN2O.C9H10N2O2/c1-14-5-3-4-6-18(14)21-9-11-22(12-10-21)19(23)17-8-7-16(20)13-15(17)2;10-9(13)8(11-6-12)7-4-2-1-3-5-7/h7-8,13-14,18H,3-6,9-12H2,1-2H3;1-6,8H,(H2,10,13)(H,11,12) |
| InChIKey | KZMDKYQTLUJUFM-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 95.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.08 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|