C27H33N5O3 — CID 142234513
2-(4-cyclohexylpiperazine-1-carbonyl)benzonitrile;2-formamido-2-phenylacetamide (PubChem CID 142234513) has the molecular formula C27H33N5O3 and a molecular weight of 475.59 g/mol. Its IUPAC name is 2-(4-cyclohexylpiperazine-1-carbonyl)benzonitrile;2-formamido-2-phenylacetamide.
| Compound Name | 2-(4-cyclohexylpiperazine-1-carbonyl)benzonitrile;2-formamido-2-phenylacetamide |
|---|---|
| PubChem CID | 142234513 |
| Molecular Formula | C27H33N5O3 |
| Molecular Weight | 475.59 g/mol |
| Exact Mass | 475.26 |
| IUPAC Name | 2-(4-cyclohexylpiperazine-1-carbonyl)benzonitrile;2-formamido-2-phenylacetamide |
| SMILES | N#Cc1ccccc1C(=O)N1CCN(C2CCCCC2)CC1.NC(=O)C(NC=O)c1ccccc1 |
| InChI | InChI=1S/C18H23N3O.C9H10N2O2/c19-14-15-6-4-5-9-17(15)18(22)21-12-10-20(11-13-21)16-7-2-1-3-8-16;10-9(13)8(11-6-12)7-4-2-1-3-5-7/h4-6,9,16H,1-3,7-8,10-13H2;1-6,8H,(H2,10,13)(H,11,12) |
| InChIKey | MNHCVFOKEIETPC-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 119.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.59 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|