C23H32N6O3 — CID 142234622
(4-cyclohexylpiperazin-1-yl)-(1H-imidazol-5-yl)methanone;2-formamido-2-phenylacetamide (PubChem CID 142234622) has the molecular formula C23H32N6O3 and a molecular weight of 440.55 g/mol. Its IUPAC name is (4-cyclohexylpiperazin-1-yl)-(1H-imidazol-5-yl)methanone;2-formamido-2-phenylacetamide.
| Compound Name | (4-cyclohexylpiperazin-1-yl)-(1H-imidazol-5-yl)methanone;2-formamido-2-phenylacetamide |
|---|---|
| PubChem CID | 142234622 |
| Molecular Formula | C23H32N6O3 |
| Molecular Weight | 440.55 g/mol |
| Exact Mass | 440.25 |
| IUPAC Name | (4-cyclohexylpiperazin-1-yl)-(1H-imidazol-5-yl)methanone;2-formamido-2-phenylacetamide |
| SMILES | NC(=O)C(NC=O)c1ccccc1.O=C(c1cnc[nH]1)N1CCN(C2CCCCC2)CC1 |
| InChI | InChI=1S/C14H22N4O.C9H10N2O2/c19-14(13-10-15-11-16-13)18-8-6-17(7-9-18)12-4-2-1-3-5-12;10-9(13)8(11-6-12)7-4-2-1-3-5-7/h10-12H,1-9H2,(H,15,16);1-6,8H,(H2,10,13)(H,11,12) |
| InChIKey | TXAVNIFFKHMJRQ-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 124.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.55 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|