C29H30ClNO3 — CID 142238359
2-chloro-N-[(3-methoxy-4-phenylmethoxyphenyl)methyl]-N-[(2E,4Z)-2-methylhexa-2,4-dienyl]benzamide (PubChem CID 142238359) has the molecular formula C29H30ClNO3 and a molecular weight of 476.02 g/mol. Its IUPAC name is 2-chloro-N-[(3-methoxy-4-phenylmethoxyphenyl)methyl]-N-[(2E,4Z)-2-methylhexa-2,4-dienyl]benzamide.
| Compound Name | 2-chloro-N-[(3-methoxy-4-phenylmethoxyphenyl)methyl]-N-[(2E,4Z)-2-methylhexa-2,4-dienyl]benzamide |
|---|---|
| PubChem CID | 142238359 |
| Molecular Formula | C29H30ClNO3 |
| Molecular Weight | 476.02 g/mol |
| Exact Mass | 475.19 |
| IUPAC Name | 2-chloro-N-[(3-methoxy-4-phenylmethoxyphenyl)methyl]-N-[(2E,4Z)-2-methylhexa-2,4-dienyl]benzamide |
| SMILES | C/C=C\C=C(/C)CN(Cc1ccc(OCc2ccccc2)c(OC)c1)C(=O)c1ccccc1Cl |
| InChI | InChI=1S/C29H30ClNO3/c1-4-5-11-22(2)19-31(29(32)25-14-9-10-15-26(25)30)20-24-16-17-27(28(18-24)33-3)34-21-23-12-7-6-8-13-23/h4-18H,19-21H2,1-3H3/b5-4-,22-11+ |
| InChIKey | DQUHVROWIZESEA-WDWJBAEWSA-N |
| XLogP | 7.09 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.02 |
| LogP ≤ 5 | 7.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|