C23H25F6NO4 — CID 142244103
1-(1-methoxyethyl)-3,5-bis(trifluoromethyl)benzene;2-methyl-3-oxo-3-(1-phenylethylamino)propanoic acid (PubChem CID 142244103) has the molecular formula C23H25F6NO4 and a molecular weight of 493.44 g/mol. Its IUPAC name is 1-(1-methoxyethyl)-3,5-bis(trifluoromethyl)benzene;2-methyl-3-oxo-3-(1-phenylethylamino)propanoic acid.
| Compound Name | 1-(1-methoxyethyl)-3,5-bis(trifluoromethyl)benzene;2-methyl-3-oxo-3-(1-phenylethylamino)propanoic acid |
|---|---|
| PubChem CID | 142244103 |
| Molecular Formula | C23H25F6NO4 |
| Molecular Weight | 493.44 g/mol |
| Exact Mass | 493.17 |
| IUPAC Name | 1-(1-methoxyethyl)-3,5-bis(trifluoromethyl)benzene;2-methyl-3-oxo-3-(1-phenylethylamino)propanoic acid |
| SMILES | CC(C(=O)O)C(=O)NC(C)c1ccccc1.COC(C)c1cc(C(F)(F)F)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C12H15NO3.C11H10F6O/c1-8(12(15)16)11(14)13-9(2)10-6-4-3-5-7-10;1-6(18-2)7-3-8(10(12,13)14)5-9(4-7)11(15,16)17/h3-9H,1-2H3,(H,13,14)(H,15,16);3-6H,1-2H3 |
| InChIKey | MQAQEPXSBVKDCI-UHFFFAOYSA-N |
| XLogP | 6.02 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.44 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|