C14H23N — CID 142245183
(2Z,3Z)-2-butan-2-ylidene-3-[(Z)-but-2-enylidene]azepane (PubChem CID 142245183) has the molecular formula C14H23N and a molecular weight of 205.34 g/mol. Its IUPAC name is (2Z,3Z)-2-butan-2-ylidene-3-[(Z)-but-2-enylidene]azepane.
| Compound Name | (2Z,3Z)-2-butan-2-ylidene-3-[(Z)-but-2-enylidene]azepane |
|---|---|
| PubChem CID | 142245183 |
| Molecular Formula | C14H23N |
| Molecular Weight | 205.34 g/mol |
| Exact Mass | 205.18 |
| IUPAC Name | (2Z,3Z)-2-butan-2-ylidene-3-[(Z)-but-2-enylidene]azepane |
| SMILES | C/C=C\C=C1\CCCCN\C1=C(\C)CC |
| InChI | InChI=1S/C14H23N/c1-4-6-9-13-10-7-8-11-15-14(13)12(3)5-2/h4,6,9,15H,5,7-8,10-11H2,1-3H3/b6-4-,13-9-,14-12- |
| InChIKey | JXGABXRVDBMBKI-QZCVTULQSA-N |
| XLogP | 3.95 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.34 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |