C19H37NO2 — CID 142251060
anisole;(3R,4R)-3-[(dimethylamino)methyl]heptan-4-ol;ethane (PubChem CID 142251060) has the molecular formula C19H37NO2 and a molecular weight of 311.51 g/mol. Its IUPAC name is anisole;(3R,4R)-3-[(dimethylamino)methyl]heptan-4-ol;ethane.
| Compound Name | anisole;(3R,4R)-3-[(dimethylamino)methyl]heptan-4-ol;ethane |
|---|---|
| PubChem CID | 142251060 |
| Molecular Formula | C19H37NO2 |
| Molecular Weight | 311.51 g/mol |
| Exact Mass | 311.28 |
| IUPAC Name | anisole;(3R,4R)-3-[(dimethylamino)methyl]heptan-4-ol;ethane |
| SMILES | CC.CCC[C@@H](O)[C@H](CC)CN(C)C.COc1ccccc1 |
| InChI | InChI=1S/C10H23NO.C7H8O.C2H6/c1-5-7-10(12)9(6-2)8-11(3)4;1-8-7-5-3-2-4-6-7;1-2/h9-10,12H,5-8H2,1-4H3;2-6H,1H3;1-2H3/t9-,10-;;/m1../s1 |
| InChIKey | UKGZCSIEGWMDIM-HSTMFJOWSA-N |
| XLogP | 4.46 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.51 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |