C15H26ClNO — CID 143616688
anisole;(2S,3R)-3-chloro-N,N,2-trimethylpentan-1-amine (PubChem CID 143616688) has the molecular formula C15H26ClNO and a molecular weight of 271.83 g/mol. Its IUPAC name is anisole;(2S,3R)-3-chloro-N,N,2-trimethylpentan-1-amine.
| Compound Name | anisole;(2S,3R)-3-chloro-N,N,2-trimethylpentan-1-amine |
|---|---|
| PubChem CID | 143616688 |
| Molecular Formula | C15H26ClNO |
| Molecular Weight | 271.83 g/mol |
| Exact Mass | 271.17 |
| IUPAC Name | anisole;(2S,3R)-3-chloro-N,N,2-trimethylpentan-1-amine |
| SMILES | CC[C@@H](Cl)[C@@H](C)CN(C)C.COc1ccccc1 |
| InChI | InChI=1S/C8H18ClN.C7H8O/c1-5-8(9)7(2)6-10(3)4;1-8-7-5-3-2-4-6-7/h7-8H,5-6H2,1-4H3;2-6H,1H3/t7-,8+;/m0./s1 |
| InChIKey | IAXYUDVRGHPQHW-KZYPOYLOSA-N |
| XLogP | 3.90 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.83 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|