C4H9N7 — CID 142259866
6-hydrazinylpyrimidine-2,4,5-triamine (PubChem CID 142259866) has the molecular formula C4H9N7 and a molecular weight of 155.17 g/mol. Its IUPAC name is 6-hydrazinylpyrimidine-2,4,5-triamine.
| Compound Name | 6-hydrazinylpyrimidine-2,4,5-triamine |
|---|---|
| PubChem CID | 142259866 |
| Molecular Formula | C4H9N7 |
| Molecular Weight | 155.17 g/mol |
| Exact Mass | 155.09 |
| IUPAC Name | 6-hydrazinylpyrimidine-2,4,5-triamine |
| SMILES | NNc1nc(N)nc(N)c1N |
| InChI | InChI=1S/C4H9N7/c5-1-2(6)9-4(7)10-3(1)11-8/h5,8H2,(H5,6,7,9,10,11) |
| InChIKey | SKZPNMQESJVVSQ-UHFFFAOYSA-N |
| XLogP | -1.49 |
| TPSA | 141.89 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 155.17 |
| LogP ≤ 5 | -1.49 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|