C15H29N3O4 — CID 142266179
ethane;methyl (2S)-4-(methyliminomethylamino)-2-[(2-methylpropan-2-yl)oxycarbonylamino]pent-4-enoate (PubChem CID 142266179) has the molecular formula C15H29N3O4 and a molecular weight of 315.41 g/mol. Its IUPAC name is ethane;methyl (2S)-4-(methyliminomethylamino)-2-[(2-methylpropan-2-yl)oxycarbonylamino]pent-4-enoate.
| Compound Name | ethane;methyl (2S)-4-(methyliminomethylamino)-2-[(2-methylpropan-2-yl)oxycarbonylamino]pent-4-enoate |
|---|---|
| PubChem CID | 142266179 |
| Molecular Formula | C15H29N3O4 |
| Molecular Weight | 315.41 g/mol |
| Exact Mass | 315.22 |
| IUPAC Name | ethane;methyl (2S)-4-(methyliminomethylamino)-2-[(2-methylpropan-2-yl)oxycarbonylamino]pent-4-enoate |
| SMILES | C=C(C[C@H](NC(=O)OC(C)(C)C)C(=O)OC)N/C=N/C.CC |
| InChI | InChI=1S/C13H23N3O4.C2H6/c1-9(15-8-14-5)7-10(11(17)19-6)16-12(18)20-13(2,3)4;1-2/h8,10H,1,7H2,2-6H3,(H,14,15)(H,16,18);1-2H3/t10-;/m0./s1 |
| InChIKey | JWRMCMZQQHVLRH-PPHPATTJSA-N |
| XLogP | 2.23 |
| TPSA | 89.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.41 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|