C14H25N3O3 — CID 178058553
methyl (Z)-5-amino-4-(methyliminomethyl)-2-[1-[(2-methylpropan-2-yl)oxy]ethenylamino]pent-4-enoate (PubChem CID 178058553) has the molecular formula C14H25N3O3 and a molecular weight of 283.37 g/mol. Its IUPAC name is methyl (Z)-5-amino-4-(methyliminomethyl)-2-[1-[(2-methylpropan-2-yl)oxy]ethenylamino]pent-4-enoate.
| Compound Name | methyl (Z)-5-amino-4-(methyliminomethyl)-2-[1-[(2-methylpropan-2-yl)oxy]ethenylamino]pent-4-enoate |
|---|---|
| PubChem CID | 178058553 |
| Molecular Formula | C14H25N3O3 |
| Molecular Weight | 283.37 g/mol |
| Exact Mass | 283.19 |
| IUPAC Name | methyl (Z)-5-amino-4-(methyliminomethyl)-2-[1-[(2-methylpropan-2-yl)oxy]ethenylamino]pent-4-enoate |
| SMILES | C=C(NC(CC(=C/N)/C=N/C)C(=O)OC)OC(C)(C)C |
| InChI | InChI=1S/C14H25N3O3/c1-10(20-14(2,3)4)17-12(13(18)19-6)7-11(8-15)9-16-5/h8-9,12,17H,1,7,15H2,2-6H3/b11-8-,16-9+ |
| InChIKey | WRTUKYHTPMORNX-GCBMJNBHSA-N |
| XLogP | 1.34 |
| TPSA | 85.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.37 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|