C15H27NO — CID 142279279
3,4-dihydro-1H-isochromene;ethane;N-methylpropan-1-amine (PubChem CID 142279279) has the molecular formula C15H27NO and a molecular weight of 237.39 g/mol. Its IUPAC name is 3,4-dihydro-1H-isochromene;ethane;N-methylpropan-1-amine.
| Compound Name | 3,4-dihydro-1H-isochromene;ethane;N-methylpropan-1-amine |
|---|---|
| PubChem CID | 142279279 |
| Molecular Formula | C15H27NO |
| Molecular Weight | 237.39 g/mol |
| Exact Mass | 237.21 |
| IUPAC Name | 3,4-dihydro-1H-isochromene;ethane;N-methylpropan-1-amine |
| SMILES | CC.CCCNC.c1ccc2c(c1)CCOC2 |
| InChI | InChI=1S/C9H10O.C4H11N.C2H6/c1-2-4-9-7-10-6-5-8(9)3-1;1-3-4-5-2;1-2/h1-4H,5-7H2;5H,3-4H2,1-2H3;1-2H3 |
| InChIKey | GECGCZJXKMHYMY-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.39 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |