C21H19ClN2 — CID 142290266
chloromethane;4-(3-phenylphenyl)-3,8a-dihydroquinazoline (PubChem CID 142290266) has the molecular formula C21H19ClN2 and a molecular weight of 334.85 g/mol. Its IUPAC name is chloromethane;4-(3-phenylphenyl)-3,8a-dihydroquinazoline.
| Compound Name | chloromethane;4-(3-phenylphenyl)-3,8a-dihydroquinazoline |
|---|---|
| PubChem CID | 142290266 |
| Molecular Formula | C21H19ClN2 |
| Molecular Weight | 334.85 g/mol |
| Exact Mass | 334.12 |
| IUPAC Name | chloromethane;4-(3-phenylphenyl)-3,8a-dihydroquinazoline |
| SMILES | C1=CC2=C(c3cccc(-c4ccccc4)c3)NC=NC2C=C1.CCl |
| InChI | InChI=1S/C20H16N2.CH3Cl/c1-2-7-15(8-3-1)16-9-6-10-17(13-16)20-18-11-4-5-12-19(18)21-14-22-20;1-2/h1-14,19H,(H,21,22);1H3 |
| InChIKey | PNSLMGZQZCGYBQ-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.85 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|