C12H18N2O2P+ — CID 142297063
2-[4-[[ethoxy(ethynyl)phosphoryl]amino]phenyl]ethylazanium (PubChem CID 142297063) has the molecular formula C12H18N2O2P+ and a molecular weight of 253.26 g/mol. Its IUPAC name is 2-[4-[[ethoxy(ethynyl)phosphoryl]amino]phenyl]ethylazanium.
| Compound Name | 2-[4-[[ethoxy(ethynyl)phosphoryl]amino]phenyl]ethylazanium |
|---|---|
| PubChem CID | 142297063 |
| Molecular Formula | C12H18N2O2P+ |
| Molecular Weight | 253.26 g/mol |
| Exact Mass | 253.11 |
| IUPAC Name | 2-[4-[[ethoxy(ethynyl)phosphoryl]amino]phenyl]ethylazanium |
| SMILES | C#CP(=O)(Nc1ccc(CC[NH3+])cc1)OCC |
| InChI | InChI=1S/C12H17N2O2P/c1-3-16-17(15,4-2)14-12-7-5-11(6-8-12)9-10-13/h2,5-8H,3,9-10,13H2,1H3,(H,14,15)/p+1 |
| InChIKey | QCQBFQMGSDVJSG-UHFFFAOYSA-O |
| XLogP | 1.70 |
| TPSA | 65.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.26 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|