C12H18NO2PS — CID 159006329
N-[ethoxy-[(Z)-2-methylsulfanylethenyl]phosphoryl]-4-methylaniline (PubChem CID 159006329) has the molecular formula C12H18NO2PS and a molecular weight of 271.32 g/mol. Its IUPAC name is N-[ethoxy-[(Z)-2-methylsulfanylethenyl]phosphoryl]-4-methylaniline.
| Compound Name | N-[ethoxy-[(Z)-2-methylsulfanylethenyl]phosphoryl]-4-methylaniline |
|---|---|
| PubChem CID | 159006329 |
| Molecular Formula | C12H18NO2PS |
| Molecular Weight | 271.32 g/mol |
| Exact Mass | 271.08 |
| IUPAC Name | N-[ethoxy-[(Z)-2-methylsulfanylethenyl]phosphoryl]-4-methylaniline |
| SMILES | CCOP(=O)(/C=C\SC)Nc1ccc(C)cc1 |
| InChI | InChI=1S/C12H18NO2PS/c1-4-15-16(14,9-10-17-3)13-12-7-5-11(2)6-8-12/h5-10H,4H2,1-3H3,(H,13,14)/b10-9- |
| InChIKey | JRYSOYXSCLBYGZ-KTKRTIGZSA-N |
| XLogP | 4.47 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.32 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|