C13H16F6NO4P — CID 58977213
2-[4-(diethoxyphosphorylamino)phenyl]-1,1,1,3,3,3-hexafluoropropan-2-ol (PubChem CID 58977213) has the molecular formula C13H16F6NO4P and a molecular weight of 395.24 g/mol. Its IUPAC name is 2-[4-(diethoxyphosphorylamino)phenyl]-1,1,1,3,3,3-hexafluoropropan-2-ol.
| Compound Name | 2-[4-(diethoxyphosphorylamino)phenyl]-1,1,1,3,3,3-hexafluoropropan-2-ol |
|---|---|
| PubChem CID | 58977213 |
| Molecular Formula | C13H16F6NO4P |
| Molecular Weight | 395.24 g/mol |
| Exact Mass | 395.07 |
| IUPAC Name | 2-[4-(diethoxyphosphorylamino)phenyl]-1,1,1,3,3,3-hexafluoropropan-2-ol |
| SMILES | CCOP(=O)(Nc1ccc(C(O)(C(F)(F)F)C(F)(F)F)cc1)OCC |
| InChI | InChI=1S/C13H16F6NO4P/c1-3-23-25(22,24-4-2)20-10-7-5-9(6-8-10)11(21,12(14,15)16)13(17,18)19/h5-8,21H,3-4H2,1-2H3,(H,20,22) |
| InChIKey | FBXZCXSVPYFIHQ-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.24 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|