C21H20F6N2O5 — CID 44968113
methyl (2R)-4-[[4-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)anilino]benzoyl]amino]-2-hydroxybutanoate (PubChem CID 44968113) has the molecular formula C21H20F6N2O5 and a molecular weight of 494.39 g/mol. Its IUPAC name is methyl (2R)-4-[[4-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)anilino]benzoyl]amino]-2-hydroxybutanoate.
| Compound Name | methyl (2R)-4-[[4-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)anilino]benzoyl]amino]-2-hydroxybutanoate |
|---|---|
| PubChem CID | 44968113 |
| Molecular Formula | C21H20F6N2O5 |
| Molecular Weight | 494.39 g/mol |
| Exact Mass | 494.13 |
| IUPAC Name | methyl (2R)-4-[[4-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)anilino]benzoyl]amino]-2-hydroxybutanoate |
| SMILES | COC(=O)[C@H](O)CCNC(=O)c1ccc(Nc2ccc(C(O)(C(F)(F)F)C(F)(F)F)cc2)cc1 |
| InChI | InChI=1S/C21H20F6N2O5/c1-34-18(32)16(30)10-11-28-17(31)12-2-6-14(7-3-12)29-15-8-4-13(5-9-15)19(33,20(22,23)24)21(25,26)27/h2-9,16,29-30,33H,10-11H2,1H3,(H,28,31)/t16-/m1/s1 |
| InChIKey | HHQLMYYEKLLPAN-MRXNPFEDSA-N |
| XLogP | 3.40 |
| TPSA | 107.89 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.39 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |