C22H29N — CID 142301630
4,13-ditert-butyl-8-methyl-8-azatetracyclo[7.5.0.02,7.010,12]tetradeca-1(9),2(7),3,5,13-pentaene (PubChem CID 142301630) has the molecular formula C22H29N and a molecular weight of 307.48 g/mol. Its IUPAC name is 4,13-ditert-butyl-8-methyl-8-azatetracyclo[7.5.0.02,7.010,12]tetradeca-1(9),2(7),3,5,13-pentaene.
| Compound Name | 4,13-ditert-butyl-8-methyl-8-azatetracyclo[7.5.0.02,7.010,12]tetradeca-1(9),2(7),3,5,13-pentaene |
|---|---|
| PubChem CID | 142301630 |
| Molecular Formula | C22H29N |
| Molecular Weight | 307.48 g/mol |
| Exact Mass | 307.23 |
| IUPAC Name | 4,13-ditert-butyl-8-methyl-8-azatetracyclo[7.5.0.02,7.010,12]tetradeca-1(9),2(7),3,5,13-pentaene |
| SMILES | Cn1c2c(c3cc(C(C)(C)C)ccc31)C=C(C(C)(C)C)C1CC21 |
| InChI | InChI=1S/C22H29N/c1-21(2,3)13-8-9-19-15(10-13)17-12-18(22(4,5)6)14-11-16(14)20(17)23(19)7/h8-10,12,14,16H,11H2,1-7H3 |
| InChIKey | KJRXZHVPWDWLDV-UHFFFAOYSA-N |
| XLogP | 6.02 |
| TPSA | 4.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.48 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |