C28H24Cl2F3N3O6 — CID 142302258
(2,2,2-trifluoroacetyl) 2-[(2,6-dichlorobenzoyl)amino]-3-[4-[[3-(pyridin-2-ylamino)cyclobutyl]oxymethyl]phenyl]propaneperoxoate (PubChem CID 142302258) has the molecular formula C28H24Cl2F3N3O6 and a molecular weight of 626.42 g/mol. Its IUPAC name is (2,2,2-trifluoroacetyl) 2-[(2,6-dichlorobenzoyl)amino]-3-[4-[[3-(pyridin-2-ylamino)cyclobutyl]oxymethyl]phenyl]propaneperoxoate.
| Compound Name | (2,2,2-trifluoroacetyl) 2-[(2,6-dichlorobenzoyl)amino]-3-[4-[[3-(pyridin-2-ylamino)cyclobutyl]oxymethyl]phenyl]propaneperoxoate |
|---|---|
| PubChem CID | 142302258 |
| Molecular Formula | C28H24Cl2F3N3O6 |
| Molecular Weight | 626.42 g/mol |
| Exact Mass | 625.10 |
| IUPAC Name | (2,2,2-trifluoroacetyl) 2-[(2,6-dichlorobenzoyl)amino]-3-[4-[[3-(pyridin-2-ylamino)cyclobutyl]oxymethyl]phenyl]propaneperoxoate |
| SMILES | O=C(NC(Cc1ccc(COC2CC(Nc3ccccn3)C2)cc1)C(=O)OOC(=O)C(F)(F)F)c1c(Cl)cccc1Cl |
| InChI | InChI=1S/C28H24Cl2F3N3O6/c29-20-4-3-5-21(30)24(20)25(37)36-22(26(38)41-42-27(39)28(31,32)33)12-16-7-9-17(10-8-16)15-40-19-13-18(14-19)35-23-6-1-2-11-34-23/h1-11,18-19,22H,12-15H2,(H,34,35)(H,36,37) |
| InChIKey | CPIBTWBZKZEQOL-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 115.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 626.42 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|