C27H32 — CID 142303229
[(1E,4E,6E)-6-ethyl-1-(6-methylcyclohexa-1,5-dien-1-yl)-3-methylidene-2-prop-1-en-2-ylocta-1,4,6-trienyl]benzene (PubChem CID 142303229) has the molecular formula C27H32 and a molecular weight of 356.55 g/mol. Its IUPAC name is [(1E,4E,6E)-6-ethyl-1-(6-methylcyclohexa-1,5-dien-1-yl)-3-methylidene-2-prop-1-en-2-ylocta-1,4,6-trienyl]benzene.
| Compound Name | [(1E,4E,6E)-6-ethyl-1-(6-methylcyclohexa-1,5-dien-1-yl)-3-methylidene-2-prop-1-en-2-ylocta-1,4,6-trienyl]benzene |
|---|---|
| PubChem CID | 142303229 |
| Molecular Formula | C27H32 |
| Molecular Weight | 356.55 g/mol |
| Exact Mass | 356.25 |
| IUPAC Name | [(1E,4E,6E)-6-ethyl-1-(6-methylcyclohexa-1,5-dien-1-yl)-3-methylidene-2-prop-1-en-2-ylocta-1,4,6-trienyl]benzene |
| SMILES | C=C(C)C(C(=C)/C=C/C(=C/C)CC)=C(C1=CCCC=C1C)c1ccccc1 |
| InChI | InChI=1S/C27H32/c1-7-23(8-2)19-18-22(6)26(20(3)4)27(24-15-10-9-11-16-24)25-17-13-12-14-21(25)5/h7,9-11,14-19H,3,6,8,12-13H2,1-2,4-5H3/b19-18+,23-7+,27-26+ |
| InChIKey | KVJNMBMNWIXABJ-VIGOKANKSA-N |
| XLogP | 8.15 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.55 |
| LogP ≤ 5 | 8.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|