C54H50N4 — CID 142304823
but-2-ene;(3Z,4E)-5-[3-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-4-ethylidene-9-methyl-3,8-bis(prop-2-enylidene)-5-azatricyclo[8.4.0.02,6]tetradeca-1,6,9,11,13-pentaene;toluene (PubChem CID 142304823) has the molecular formula C54H50N4 and a molecular weight of 755.02 g/mol. Its IUPAC name is but-2-ene;(3Z,4E)-5-[3-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-4-ethylidene-9-methyl-3,8-bis(prop-2-enylidene)-5-azatricyclo[8.4.0.02,6]tetradeca-1,6,9,11,13-pentaene;toluene.
| Compound Name | but-2-ene;(3Z,4E)-5-[3-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-4-ethylidene-9-methyl-3,8-bis(prop-2-enylidene)-5-azatricyclo[8.4.0.02,6]tetradeca-1,6,9,11,13-pentaene;toluene |
|---|---|
| PubChem CID | 142304823 |
| Molecular Formula | C54H50N4 |
| Molecular Weight | 755.02 g/mol |
| Exact Mass | 754.40 |
| IUPAC Name | but-2-ene;(3Z,4E)-5-[3-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-4-ethylidene-9-methyl-3,8-bis(prop-2-enylidene)-5-azatricyclo[8.4.0.02,6]tetradeca-1,6,9,11,13-pentaene;toluene |
| SMILES | C=CC=C1C=c2c(c(=C/C=C)/c(=C\C)n2-c2cccc(-c3nc(-c4ccccc4)nc(-c4ccccc4)n3)c2)=c2ccccc2=C1C.CC=CC.Cc1ccccc1 |
| InChI | InChI=1S/C43H34N4.C7H8.C4H8/c1-5-17-32-28-39-40(36-26-15-14-25-35(36)29(32)4)37(18-6-2)38(7-3)47(39)34-24-16-23-33(27-34)43-45-41(30-19-10-8-11-20-30)44-42(46-43)31-21-12-9-13-22-31;1-7-5-3-2-4-6-7;1-3-4-2/h5-28H,1-2H2,3-4H3;2-6H,1H3;3-4H,1-2H3/b32-17?,37-18+,38-7+;; |
| InChIKey | NYVPTINJSYPZHR-CBQDRYTFSA-N |
| XLogP | 10.37 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 755.02 |
| LogP ≤ 5 | 10.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|