C34H39N3O5S — CID 142314408
2-[3-(1,3-benzothiazol-2-yl)-7-(diethylamino)-2-oxochromen-4-yl]benzaldehyde;ethane;4-(methylamino)butanoic acid (PubChem CID 142314408) has the molecular formula C34H39N3O5S and a molecular weight of 601.77 g/mol. Its IUPAC name is 2-[3-(1,3-benzothiazol-2-yl)-7-(diethylamino)-2-oxochromen-4-yl]benzaldehyde;ethane;4-(methylamino)butanoic acid.
| Compound Name | 2-[3-(1,3-benzothiazol-2-yl)-7-(diethylamino)-2-oxochromen-4-yl]benzaldehyde;ethane;4-(methylamino)butanoic acid |
|---|---|
| PubChem CID | 142314408 |
| Molecular Formula | C34H39N3O5S |
| Molecular Weight | 601.77 g/mol |
| Exact Mass | 601.26 |
| IUPAC Name | 2-[3-(1,3-benzothiazol-2-yl)-7-(diethylamino)-2-oxochromen-4-yl]benzaldehyde;ethane;4-(methylamino)butanoic acid |
| SMILES | CC.CCN(CC)c1ccc2c(-c3ccccc3C=O)c(-c3nc4ccccc4s3)c(=O)oc2c1.CNCCCC(=O)O |
| InChI | InChI=1S/C27H22N2O3S.C5H11NO2.C2H6/c1-3-29(4-2)18-13-14-20-22(15-18)32-27(31)25(24(20)19-10-6-5-9-17(19)16-30)26-28-21-11-7-8-12-23(21)33-26;1-6-4-2-3-5(7)8;1-2/h5-16H,3-4H2,1-2H3;6H,2-4H2,1H3,(H,7,8);1-2H3 |
| InChIKey | SRFWHGIVHUJFBJ-UHFFFAOYSA-N |
| XLogP | 7.49 |
| TPSA | 112.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 601.77 |
| LogP ≤ 5 | 7.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|