C10H12N4 — CID 142333101
5-ethyl-2-(3-methyl-1,2,4-triazol-1-yl)pyridine (PubChem CID 142333101) has the molecular formula C10H12N4 and a molecular weight of 188.23 g/mol. Its IUPAC name is 5-ethyl-2-(3-methyl-1,2,4-triazol-1-yl)pyridine.
| Compound Name | 5-ethyl-2-(3-methyl-1,2,4-triazol-1-yl)pyridine |
|---|---|
| PubChem CID | 142333101 |
| Molecular Formula | C10H12N4 |
| Molecular Weight | 188.23 g/mol |
| Exact Mass | 188.11 |
| IUPAC Name | 5-ethyl-2-(3-methyl-1,2,4-triazol-1-yl)pyridine |
| SMILES | CCc1ccc(-n2cnc(C)n2)nc1 |
| InChI | InChI=1S/C10H12N4/c1-3-9-4-5-10(11-6-9)14-7-12-8(2)13-14/h4-7H,3H2,1-2H3 |
| InChIKey | JQXRFXZRRJGEPG-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.23 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |