C25H30F2IN8PS — CID 142335136
2-(difluoromethyl)-3-iodophosphanyl-7-N-[2-[methyl(methylsulfanyl)amino]-4-(1-methylpyrazol-4-yl)phenyl]imidazo[4,5-b]pyridine-5,7-diamine;1-ethenyl-2-methylcyclopropane (PubChem CID 142335136) has the molecular formula C25H30F2IN8PS and a molecular weight of 670.51 g/mol. Its IUPAC name is 2-(difluoromethyl)-3-iodophosphanyl-7-N-[2-[methyl(methylsulfanyl)amino]-4-(1-methylpyrazol-4-yl)phenyl]imidazo[4,5-b]pyridine-5,7-diamine;1-ethenyl-2-methylcyclopropane.
| Compound Name | 2-(difluoromethyl)-3-iodophosphanyl-7-N-[2-[methyl(methylsulfanyl)amino]-4-(1-methylpyrazol-4-yl)phenyl]imidazo[4,5-b]pyridine-5,7-diamine;1-ethenyl-2-methylcyclopropane |
|---|---|
| PubChem CID | 142335136 |
| Molecular Formula | C25H30F2IN8PS |
| Molecular Weight | 670.51 g/mol |
| Exact Mass | 670.11 |
| IUPAC Name | 2-(difluoromethyl)-3-iodophosphanyl-7-N-[2-[methyl(methylsulfanyl)amino]-4-(1-methylpyrazol-4-yl)phenyl]imidazo[4,5-b]pyridine-5,7-diamine;1-ethenyl-2-methylcyclopropane |
| SMILES | C=CC1CC1C.CSN(C)c1cc(-c2cnn(C)c2)ccc1Nc1cc(N)nc2c1nc(C(F)F)n2PI |
| InChI | InChI=1S/C19H20F2IN8PS.C6H10/c1-28-9-11(8-24-28)10-4-5-12(14(6-10)29(2)32-3)25-13-7-15(23)26-18-16(13)27-19(17(20)21)30(18)31-22;1-3-6-4-5(6)2/h4-9,17,31H,1-3H3,(H3,23,25,26);3,5-6H,1,4H2,2H3 |
| InChIKey | JVKZNZXVEILRQE-UHFFFAOYSA-N |
| XLogP | 7.43 |
| TPSA | 89.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 670.51 |
| LogP ≤ 5 | 7.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|