C22H23FO — CID 142370781
[4-[2-fluoro-4-[(3Z)-5-methylideneocta-1,3-dien-2-yl]phenyl]phenyl]methanol (PubChem CID 142370781) has the molecular formula C22H23FO and a molecular weight of 322.42 g/mol. Its IUPAC name is [4-[2-fluoro-4-[(3Z)-5-methylideneocta-1,3-dien-2-yl]phenyl]phenyl]methanol.
| Compound Name | [4-[2-fluoro-4-[(3Z)-5-methylideneocta-1,3-dien-2-yl]phenyl]phenyl]methanol |
|---|---|
| PubChem CID | 142370781 |
| Molecular Formula | C22H23FO |
| Molecular Weight | 322.42 g/mol |
| Exact Mass | 322.17 |
| IUPAC Name | [4-[2-fluoro-4-[(3Z)-5-methylideneocta-1,3-dien-2-yl]phenyl]phenyl]methanol |
| SMILES | C=C(/C=C\C(=C)c1ccc(-c2ccc(CO)cc2)c(F)c1)CCC |
| InChI | InChI=1S/C22H23FO/c1-4-5-16(2)6-7-17(3)20-12-13-21(22(23)14-20)19-10-8-18(15-24)9-11-19/h6-14,24H,2-5,15H2,1H3/b7-6- |
| InChIKey | BWVCCLBQHLYOQT-SREVYHEPSA-N |
| XLogP | 5.91 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.42 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|